C14H22N2S2 — CID 105298978
[2-cyclopentyl-1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)ethyl]hydrazine (PubChem CID 105298978) has the molecular formula C14H22N2S2 and a molecular weight of 282.48 g/mol. Its IUPAC name is [2-cyclopentyl-1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)ethyl]hydrazine.
| Compound Name | [2-cyclopentyl-1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105298978 |
| Molecular Formula | C14H22N2S2 |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | [2-cyclopentyl-1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)ethyl]hydrazine |
| SMILES | NNC(CC1CCCC1)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C14H22N2S2/c15-16-12(7-10-3-1-2-4-10)14-8-11-9-17-6-5-13(11)18-14/h8,10,12,16H,1-7,9,15H2 |
| InChIKey | RPJLTYFJVDXGTQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|