C13H16N2S3 — CID 105297674
[1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-2-thiophen-3-ylethyl]hydrazine (PubChem CID 105297674) has the molecular formula C13H16N2S3 and a molecular weight of 296.49 g/mol. Its IUPAC name is [1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-2-thiophen-3-ylethyl]hydrazine.
| Compound Name | [1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-2-thiophen-3-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105297674 |
| Molecular Formula | C13H16N2S3 |
| Molecular Weight | 296.49 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | [1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-2-thiophen-3-ylethyl]hydrazine |
| SMILES | NNC(Cc1ccsc1)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C13H16N2S3/c14-15-11(5-9-1-3-16-7-9)13-6-10-8-17-4-2-12(10)18-13/h1,3,6-7,11,15H,2,4-5,8,14H2 |
| InChIKey | LSWNECYKJRWTGX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|