C14H20N4S2 — CID 103025947
[1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-3-(2-methylpyrazol-3-yl)propyl]hydrazine (PubChem CID 103025947) has the molecular formula C14H20N4S2 and a molecular weight of 308.48 g/mol. Its IUPAC name is [1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-3-(2-methylpyrazol-3-yl)propyl]hydrazine.
| Compound Name | [1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-3-(2-methylpyrazol-3-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 103025947 |
| Molecular Formula | C14H20N4S2 |
| Molecular Weight | 308.48 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | [1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-3-(2-methylpyrazol-3-yl)propyl]hydrazine |
| SMILES | Cn1nccc1CCC(NN)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C14H20N4S2/c1-18-11(4-6-16-18)2-3-12(17-15)14-8-10-9-19-7-5-13(10)20-14/h4,6,8,12,17H,2-3,5,7,9,15H2,1H3 |
| InChIKey | KNQFPCNVEMCIJV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|