C12H20N6 — CID 103026121
[1-(1,3-dimethylpyrazol-4-yl)-3-(2-methylpyrazol-3-yl)propyl]hydrazine (PubChem CID 103026121) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is [1-(1,3-dimethylpyrazol-4-yl)-3-(2-methylpyrazol-3-yl)propyl]hydrazine.
| Compound Name | [1-(1,3-dimethylpyrazol-4-yl)-3-(2-methylpyrazol-3-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 103026121 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | [1-(1,3-dimethylpyrazol-4-yl)-3-(2-methylpyrazol-3-yl)propyl]hydrazine |
| SMILES | Cc1nn(C)cc1C(CCc1ccnn1C)NN |
| InChI | InChI=1S/C12H20N6/c1-9-11(8-17(2)16-9)12(15-13)5-4-10-6-7-14-18(10)3/h6-8,12,15H,4-5,13H2,1-3H3 |
| InChIKey | HOOHIWSEOUPFOY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|