C10H17N7 — CID 102805022
[1-(1,3-dimethylpyrazol-4-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 102805022) has the molecular formula C10H17N7 and a molecular weight of 235.29 g/mol. Its IUPAC name is [1-(1,3-dimethylpyrazol-4-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(1,3-dimethylpyrazol-4-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102805022 |
| Molecular Formula | C10H17N7 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | [1-(1,3-dimethylpyrazol-4-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | Cc1nn(C)cc1C(Cc1ncnn1C)NN |
| InChI | InChI=1S/C10H17N7/c1-7-8(5-16(2)15-7)9(14-11)4-10-12-6-13-17(10)3/h5-6,9,14H,4,11H2,1-3H3 |
| InChIKey | RMHBIBBHFXJTOU-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|