C10H15N7 — CID 105316546
[1-(5-methylpyrazin-2-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105316546) has the molecular formula C10H15N7 and a molecular weight of 233.28 g/mol. Its IUPAC name is [1-(5-methylpyrazin-2-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(5-methylpyrazin-2-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105316546 |
| Molecular Formula | C10H15N7 |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | [1-(5-methylpyrazin-2-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | Cc1cnc(C(Cc2ncnn2C)NN)cn1 |
| InChI | InChI=1S/C10H15N7/c1-7-4-13-9(5-12-7)8(16-11)3-10-14-6-15-17(10)2/h4-6,8,16H,3,11H2,1-2H3 |
| InChIKey | RJPKROSOABBEMD-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|