C10H15N7O — CID 103375604
[1-(6-methoxypyridazin-3-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 103375604) has the molecular formula C10H15N7O and a molecular weight of 249.28 g/mol. Its IUPAC name is [1-(6-methoxypyridazin-3-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(6-methoxypyridazin-3-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 103375604 |
| Molecular Formula | C10H15N7O |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | [1-(6-methoxypyridazin-3-yl)-2-(2-methyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | COc1ccc(C(Cc2ncnn2C)NN)nn1 |
| InChI | InChI=1S/C10H15N7O/c1-17-9(12-6-13-17)5-8(14-11)7-3-4-10(18-2)16-15-7/h3-4,6,8,14H,5,11H2,1-2H3 |
| InChIKey | UHPHPAZFXPHRBC-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|