C14H18N4O — CID 103375674
[1-(6-methoxypyridazin-3-yl)-2-(2-methylphenyl)ethyl]hydrazine (PubChem CID 103375674) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is [1-(6-methoxypyridazin-3-yl)-2-(2-methylphenyl)ethyl]hydrazine.
| Compound Name | [1-(6-methoxypyridazin-3-yl)-2-(2-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 103375674 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | [1-(6-methoxypyridazin-3-yl)-2-(2-methylphenyl)ethyl]hydrazine |
| SMILES | COc1ccc(C(Cc2ccccc2C)NN)nn1 |
| InChI | InChI=1S/C14H18N4O/c1-10-5-3-4-6-11(10)9-13(16-15)12-7-8-14(19-2)18-17-12/h3-8,13,16H,9,15H2,1-2H3 |
| InChIKey | QCPFZLCJVQZCCO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|