C10H14N6 — CID 105196128
[2-(2-methyl-1,2,4-triazol-3-yl)-1-pyridin-3-ylethyl]hydrazine (PubChem CID 105196128) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is [2-(2-methyl-1,2,4-triazol-3-yl)-1-pyridin-3-ylethyl]hydrazine.
| Compound Name | [2-(2-methyl-1,2,4-triazol-3-yl)-1-pyridin-3-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105196128 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | [2-(2-methyl-1,2,4-triazol-3-yl)-1-pyridin-3-ylethyl]hydrazine |
| SMILES | Cn1ncnc1CC(NN)c1cccnc1 |
| InChI | InChI=1S/C10H14N6/c1-16-10(13-7-14-16)5-9(15-11)8-3-2-4-12-6-8/h2-4,6-7,9,15H,5,11H2,1H3 |
| InChIKey | CXLIPWFOGJMAQW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|