C13H19N5 — CID 105199354
[1-phenyl-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105199354) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is [1-phenyl-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-phenyl-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105199354 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | [1-phenyl-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CCCn1ncnc1CC(NN)c1ccccc1 |
| InChI | InChI=1S/C13H19N5/c1-2-8-18-13(15-10-16-18)9-12(17-14)11-6-4-3-5-7-11/h3-7,10,12,17H,2,8-9,14H2,1H3 |
| InChIKey | FYLWOGKZJAUANY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|