C14H21N5S — CID 105319203
[1-(4-methylsulfanylphenyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105319203) has the molecular formula C14H21N5S and a molecular weight of 291.42 g/mol. Its IUPAC name is [1-(4-methylsulfanylphenyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(4-methylsulfanylphenyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105319203 |
| Molecular Formula | C14H21N5S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | [1-(4-methylsulfanylphenyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CCCn1ncnc1CC(NN)c1ccc(SC)cc1 |
| InChI | InChI=1S/C14H21N5S/c1-3-8-19-14(16-10-17-19)9-13(18-15)11-4-6-12(20-2)7-5-11/h4-7,10,13,18H,3,8-9,15H2,1-2H3 |
| InChIKey | BHWRFQSATUIIKS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|