C14H20FN5S — CID 105236753
[1-(4-fluorophenyl)sulfanyl-3-(2-propyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105236753) has the molecular formula C14H20FN5S and a molecular weight of 309.41 g/mol. Its IUPAC name is [1-(4-fluorophenyl)sulfanyl-3-(2-propyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(4-fluorophenyl)sulfanyl-3-(2-propyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105236753 |
| Molecular Formula | C14H20FN5S |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | [1-(4-fluorophenyl)sulfanyl-3-(2-propyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
| SMILES | CCCn1ncnc1CC(CSc1ccc(F)cc1)NN |
| InChI | InChI=1S/C14H20FN5S/c1-2-7-20-14(17-10-18-20)8-12(19-16)9-21-13-5-3-11(15)4-6-13/h3-6,10,12,19H,2,7-9,16H2,1H3 |
| InChIKey | AJZMYNBTYOPPFW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|