C10H21N5O — CID 105206476
[4-methoxy-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-yl]hydrazine (PubChem CID 105206476) has the molecular formula C10H21N5O and a molecular weight of 227.31 g/mol. Its IUPAC name is [4-methoxy-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-yl]hydrazine.
| Compound Name | [4-methoxy-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105206476 |
| Molecular Formula | C10H21N5O |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | [4-methoxy-1-(2-propyl-1,2,4-triazol-3-yl)butan-2-yl]hydrazine |
| SMILES | CCCn1ncnc1CC(CCOC)NN |
| InChI | InChI=1S/C10H21N5O/c1-3-5-15-10(12-8-13-15)7-9(14-11)4-6-16-2/h8-9,14H,3-7,11H2,1-2H3 |
| InChIKey | MKJXQZCRCWDWTA-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|