C11H23N5O — CID 105318513
[5-ethoxy-1-(2-ethyl-1,2,4-triazol-3-yl)pentan-2-yl]hydrazine (PubChem CID 105318513) has the molecular formula C11H23N5O and a molecular weight of 241.34 g/mol. Its IUPAC name is [5-ethoxy-1-(2-ethyl-1,2,4-triazol-3-yl)pentan-2-yl]hydrazine.
| Compound Name | [5-ethoxy-1-(2-ethyl-1,2,4-triazol-3-yl)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105318513 |
| Molecular Formula | C11H23N5O |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | [5-ethoxy-1-(2-ethyl-1,2,4-triazol-3-yl)pentan-2-yl]hydrazine |
| SMILES | CCOCCCC(Cc1ncnn1CC)NN |
| InChI | InChI=1S/C11H23N5O/c1-3-16-11(13-9-14-16)8-10(15-12)6-5-7-17-4-2/h9-10,15H,3-8,12H2,1-2H3 |
| InChIKey | TVRZROJOGIDQMV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|