C9H17N5 — CID 105269736
1-(2-ethyl-1,2,4-triazol-3-yl)pent-4-en-2-ylhydrazine (PubChem CID 105269736) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 1-(2-ethyl-1,2,4-triazol-3-yl)pent-4-en-2-ylhydrazine.
| Compound Name | 1-(2-ethyl-1,2,4-triazol-3-yl)pent-4-en-2-ylhydrazine |
|---|---|
| PubChem CID | 105269736 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 1-(2-ethyl-1,2,4-triazol-3-yl)pent-4-en-2-ylhydrazine |
| SMILES | C=CCC(Cc1ncnn1CC)NN |
| InChI | InChI=1S/C9H17N5/c1-3-5-8(13-10)6-9-11-7-12-14(9)4-2/h3,7-8,13H,1,4-6,10H2,2H3 |
| InChIKey | IHABMIOYKNAPFT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|