C10H18N4 — CID 116660609
1-(2-ethyl-1,2,4-triazol-3-yl)-N-methylpent-4-en-2-amine (PubChem CID 116660609) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(2-ethyl-1,2,4-triazol-3-yl)-N-methylpent-4-en-2-amine.
| Compound Name | 1-(2-ethyl-1,2,4-triazol-3-yl)-N-methylpent-4-en-2-amine |
|---|---|
| PubChem CID | 116660609 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-(2-ethyl-1,2,4-triazol-3-yl)-N-methylpent-4-en-2-amine |
| SMILES | C=CCC(Cc1ncnn1CC)NC |
| InChI | InChI=1S/C10H18N4/c1-4-6-9(11-3)7-10-12-8-13-14(10)5-2/h4,8-9,11H,1,5-7H2,2-3H3 |
| InChIKey | ZNYBTZQZOFRCNF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|