C14H27N5 — CID 105318460
[1-cycloheptyl-3-(2-ethyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105318460) has the molecular formula C14H27N5 and a molecular weight of 265.40 g/mol. Its IUPAC name is [1-cycloheptyl-3-(2-ethyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-cycloheptyl-3-(2-ethyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105318460 |
| Molecular Formula | C14H27N5 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.23 |
| IUPAC Name | [1-cycloheptyl-3-(2-ethyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
| SMILES | CCn1ncnc1CC(CC1CCCCCC1)NN |
| InChI | InChI=1S/C14H27N5/c1-2-19-14(16-11-17-19)10-13(18-15)9-12-7-5-3-4-6-8-12/h11-13,18H,2-10,15H2,1H3 |
| InChIKey | AWPAJRJOJAIXPQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|