C9H16N4 — CID 116660545
N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)pent-4-en-2-amine (PubChem CID 116660545) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)pent-4-en-2-amine.
| Compound Name | N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 116660545 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N-methyl-1-(2-methyl-1,2,4-triazol-3-yl)pent-4-en-2-amine |
| SMILES | C=CCC(Cc1ncnn1C)NC |
| InChI | InChI=1S/C9H16N4/c1-4-5-8(10-2)6-9-11-7-12-13(9)3/h4,7-8,10H,1,5-6H2,2-3H3 |
| InChIKey | OEHBAWXLRMYLIA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|