C8H17N5S — CID 105225311
[1-ethylsulfanyl-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105225311) has the molecular formula C8H17N5S and a molecular weight of 215.33 g/mol. Its IUPAC name is [1-ethylsulfanyl-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-ethylsulfanyl-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105225311 |
| Molecular Formula | C8H17N5S |
| Molecular Weight | 215.33 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | [1-ethylsulfanyl-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
| SMILES | CCSCC(Cc1ncnn1C)NN |
| InChI | InChI=1S/C8H17N5S/c1-3-14-5-7(12-9)4-8-10-6-11-13(8)2/h6-7,12H,3-5,9H2,1-2H3 |
| InChIKey | KWJQLAKEENDRPA-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|