C12H15ClFN5 — CID 105264351
[1-(3-chloro-2-fluorophenyl)-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105264351) has the molecular formula C12H15ClFN5 and a molecular weight of 283.74 g/mol. Its IUPAC name is [1-(3-chloro-2-fluorophenyl)-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(3-chloro-2-fluorophenyl)-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105264351 |
| Molecular Formula | C12H15ClFN5 |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [1-(3-chloro-2-fluorophenyl)-3-(2-methyl-1,2,4-triazol-3-yl)propan-2-yl]hydrazine |
| SMILES | Cn1ncnc1CC(Cc1cccc(Cl)c1F)NN |
| InChI | InChI=1S/C12H15ClFN5/c1-19-11(16-7-17-19)6-9(18-15)5-8-3-2-4-10(13)12(8)14/h2-4,7,9,18H,5-6,15H2,1H3 |
| InChIKey | MDELPLSZZFHACW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|