C14H17ClFN3S — CID 105264290
[1-(3-chloro-2-fluorophenyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine (PubChem CID 105264290) has the molecular formula C14H17ClFN3S and a molecular weight of 313.83 g/mol. Its IUPAC name is [1-(3-chloro-2-fluorophenyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(3-chloro-2-fluorophenyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105264290 |
| Molecular Formula | C14H17ClFN3S |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | [1-(3-chloro-2-fluorophenyl)-3-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-yl]hydrazine |
| SMILES | Cc1nc(CC(Cc2cccc(Cl)c2F)NN)sc1C |
| InChI | InChI=1S/C14H17ClFN3S/c1-8-9(2)20-13(18-8)7-11(19-17)6-10-4-3-5-12(15)14(10)16/h3-5,11,19H,6-7,17H2,1-2H3 |
| InChIKey | WFJQXDKJPFKKCG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|