C14H19N3OS — CID 105212902
[1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenoxypropan-2-yl]hydrazine (PubChem CID 105212902) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is [1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenoxypropan-2-yl]hydrazine.
| Compound Name | [1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenoxypropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105212902 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | [1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-phenoxypropan-2-yl]hydrazine |
| SMILES | Cc1nc(CC(COc2ccccc2)NN)sc1C |
| InChI | InChI=1S/C14H19N3OS/c1-10-11(2)19-14(16-10)8-12(17-15)9-18-13-6-4-3-5-7-13/h3-7,12,17H,8-9,15H2,1-2H3 |
| InChIKey | QNWWQNHKKWASTG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|