C12H23N3O2S — CID 102929930
[1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine (PubChem CID 102929930) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine.
| Compound Name | [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 102929930 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | [1-(4,5-dimethyl-1,3-thiazol-2-yl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine |
| SMILES | COCCOCCC(Cc1nc(C)c(C)s1)NN |
| InChI | InChI=1S/C12H23N3O2S/c1-9-10(2)18-12(14-9)8-11(15-13)4-5-17-7-6-16-3/h11,15H,4-8,13H2,1-3H3 |
| InChIKey | PBPPFQNZOGHRPP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|