C11H19BrN2O2S — CID 102929781
[1-(3-bromothiophen-2-yl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine (PubChem CID 102929781) has the molecular formula C11H19BrN2O2S and a molecular weight of 323.26 g/mol. Its IUPAC name is [1-(3-bromothiophen-2-yl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine.
| Compound Name | [1-(3-bromothiophen-2-yl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 102929781 |
| Molecular Formula | C11H19BrN2O2S |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | [1-(3-bromothiophen-2-yl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine |
| SMILES | COCCOCCC(Cc1sccc1Br)NN |
| InChI | InChI=1S/C11H19BrN2O2S/c1-15-5-6-16-4-2-9(14-13)8-11-10(12)3-7-17-11/h3,7,9,14H,2,4-6,8,13H2,1H3 |
| InChIKey | GKTMMACGRGIYDP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|