C13H20BrFN2O2 — CID 102929724
[1-(2-bromo-3-fluorophenyl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine (PubChem CID 102929724) has the molecular formula C13H20BrFN2O2 and a molecular weight of 335.22 g/mol. Its IUPAC name is [1-(2-bromo-3-fluorophenyl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine.
| Compound Name | [1-(2-bromo-3-fluorophenyl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 102929724 |
| Molecular Formula | C13H20BrFN2O2 |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [1-(2-bromo-3-fluorophenyl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine |
| SMILES | COCCOCCC(Cc1cccc(F)c1Br)NN |
| InChI | InChI=1S/C13H20BrFN2O2/c1-18-7-8-19-6-5-11(17-16)9-10-3-2-4-12(15)13(10)14/h2-4,11,17H,5-9,16H2,1H3 |
| InChIKey | KSRUXDIXUWHUQE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|