C13H20ClFN2O2 — CID 102929991
[1-(4-chloro-2-fluorophenyl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine (PubChem CID 102929991) has the molecular formula C13H20ClFN2O2 and a molecular weight of 290.77 g/mol. Its IUPAC name is [1-(4-chloro-2-fluorophenyl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine.
| Compound Name | [1-(4-chloro-2-fluorophenyl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 102929991 |
| Molecular Formula | C13H20ClFN2O2 |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [1-(4-chloro-2-fluorophenyl)-4-(2-methoxyethoxy)butan-2-yl]hydrazine |
| SMILES | COCCOCCC(Cc1ccc(Cl)cc1F)NN |
| InChI | InChI=1S/C13H20ClFN2O2/c1-18-6-7-19-5-4-12(17-16)8-10-2-3-11(14)9-13(10)15/h2-3,9,12,17H,4-8,16H2,1H3 |
| InChIKey | BMRYJOAUCXESQO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|