C12H19ClN2O — CID 106868463
[1-(2-chloro-4-methylphenyl)-4-methoxybutan-2-yl]hydrazine (PubChem CID 106868463) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is [1-(2-chloro-4-methylphenyl)-4-methoxybutan-2-yl]hydrazine.
| Compound Name | [1-(2-chloro-4-methylphenyl)-4-methoxybutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 106868463 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [1-(2-chloro-4-methylphenyl)-4-methoxybutan-2-yl]hydrazine |
| SMILES | COCCC(Cc1ccc(C)cc1Cl)NN |
| InChI | InChI=1S/C12H19ClN2O/c1-9-3-4-10(12(13)7-9)8-11(15-14)5-6-16-2/h3-4,7,11,15H,5-6,8,14H2,1-2H3 |
| InChIKey | AMYFTSZKKOWABZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|