C16H20ClN3 — CID 106868466
[1-(2-chloro-4-methylphenyl)-4-pyridin-4-ylbutan-2-yl]hydrazine (PubChem CID 106868466) has the molecular formula C16H20ClN3 and a molecular weight of 289.81 g/mol. Its IUPAC name is [1-(2-chloro-4-methylphenyl)-4-pyridin-4-ylbutan-2-yl]hydrazine.
| Compound Name | [1-(2-chloro-4-methylphenyl)-4-pyridin-4-ylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 106868466 |
| Molecular Formula | C16H20ClN3 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [1-(2-chloro-4-methylphenyl)-4-pyridin-4-ylbutan-2-yl]hydrazine |
| SMILES | Cc1ccc(CC(CCc2ccncc2)NN)c(Cl)c1 |
| InChI | InChI=1S/C16H20ClN3/c1-12-2-4-14(16(17)10-12)11-15(20-18)5-3-13-6-8-19-9-7-13/h2,4,6-10,15,20H,3,5,11,18H2,1H3 |
| InChIKey | ZOQOZMBHUSPXOF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|