C11H16BrClN2O — CID 105206418
[1-(4-bromo-2-chlorophenyl)-4-methoxybutan-2-yl]hydrazine (PubChem CID 105206418) has the molecular formula C11H16BrClN2O and a molecular weight of 307.62 g/mol. Its IUPAC name is [1-(4-bromo-2-chlorophenyl)-4-methoxybutan-2-yl]hydrazine.
| Compound Name | [1-(4-bromo-2-chlorophenyl)-4-methoxybutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105206418 |
| Molecular Formula | C11H16BrClN2O |
| Molecular Weight | 307.62 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | [1-(4-bromo-2-chlorophenyl)-4-methoxybutan-2-yl]hydrazine |
| SMILES | COCCC(Cc1ccc(Br)cc1Cl)NN |
| InChI | InChI=1S/C11H16BrClN2O/c1-16-5-4-10(15-14)6-8-2-3-9(12)7-11(8)13/h2-3,7,10,15H,4-6,14H2,1H3 |
| InChIKey | WGGODHLLNURJBH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.62 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|