C15H20BrClN4 — CID 105335286
[1-(4-bromo-2-chlorophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-yl]hydrazine (PubChem CID 105335286) has the molecular formula C15H20BrClN4 and a molecular weight of 371.71 g/mol. Its IUPAC name is [1-(4-bromo-2-chlorophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(4-bromo-2-chlorophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105335286 |
| Molecular Formula | C15H20BrClN4 |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | [1-(4-bromo-2-chlorophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-yl]hydrazine |
| SMILES | Cc1nn(C)c(C)c1CC(Cc1ccc(Br)cc1Cl)NN |
| InChI | InChI=1S/C15H20BrClN4/c1-9-14(10(2)21(3)20-9)8-13(19-18)6-11-4-5-12(16)7-15(11)17/h4-5,7,13,19H,6,8,18H2,1-3H3 |
| InChIKey | DJZWERJOJXPWSO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|