C16H27ClN2 — CID 106868573
[1-(2-chloro-4-methylphenyl)-4,5,5-trimethylhexan-2-yl]hydrazine (PubChem CID 106868573) has the molecular formula C16H27ClN2 and a molecular weight of 282.86 g/mol. Its IUPAC name is [1-(2-chloro-4-methylphenyl)-4,5,5-trimethylhexan-2-yl]hydrazine.
| Compound Name | [1-(2-chloro-4-methylphenyl)-4,5,5-trimethylhexan-2-yl]hydrazine |
|---|---|
| PubChem CID | 106868573 |
| Molecular Formula | C16H27ClN2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | [1-(2-chloro-4-methylphenyl)-4,5,5-trimethylhexan-2-yl]hydrazine |
| SMILES | Cc1ccc(CC(CC(C)C(C)(C)C)NN)c(Cl)c1 |
| InChI | InChI=1S/C16H27ClN2/c1-11-6-7-13(15(17)8-11)10-14(19-18)9-12(2)16(3,4)5/h6-8,12,14,19H,9-10,18H2,1-5H3 |
| InChIKey | GRKHCSVTEPBZCU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|