C13H23ClN2S — CID 105296073
[1-(5-chlorothiophen-2-yl)-4,5,5-trimethylhexan-2-yl]hydrazine (PubChem CID 105296073) has the molecular formula C13H23ClN2S and a molecular weight of 274.86 g/mol. Its IUPAC name is [1-(5-chlorothiophen-2-yl)-4,5,5-trimethylhexan-2-yl]hydrazine.
| Compound Name | [1-(5-chlorothiophen-2-yl)-4,5,5-trimethylhexan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105296073 |
| Molecular Formula | C13H23ClN2S |
| Molecular Weight | 274.86 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | [1-(5-chlorothiophen-2-yl)-4,5,5-trimethylhexan-2-yl]hydrazine |
| SMILES | CC(CC(Cc1ccc(Cl)s1)NN)C(C)(C)C |
| InChI | InChI=1S/C13H23ClN2S/c1-9(13(2,3)4)7-10(16-15)8-11-5-6-12(14)17-11/h5-6,9-10,16H,7-8,15H2,1-4H3 |
| InChIKey | DTVKTZSVJKRTDN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|