C9H15ClN2S — CID 105199674
[1-(5-chlorothiophen-2-yl)-3-methylbutan-2-yl]hydrazine (PubChem CID 105199674) has the molecular formula C9H15ClN2S and a molecular weight of 218.75 g/mol. Its IUPAC name is [1-(5-chlorothiophen-2-yl)-3-methylbutan-2-yl]hydrazine.
| Compound Name | [1-(5-chlorothiophen-2-yl)-3-methylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105199674 |
| Molecular Formula | C9H15ClN2S |
| Molecular Weight | 218.75 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | [1-(5-chlorothiophen-2-yl)-3-methylbutan-2-yl]hydrazine |
| SMILES | CC(C)C(Cc1ccc(Cl)s1)NN |
| InChI | InChI=1S/C9H15ClN2S/c1-6(2)8(12-11)5-7-3-4-9(10)13-7/h3-4,6,8,12H,5,11H2,1-2H3 |
| InChIKey | XXAVNRHGRGNDOM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.75 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|