C12H17ClN2S — CID 105296014
[1-(6-bicyclo[3.1.0]hexanyl)-2-(5-chlorothiophen-2-yl)ethyl]hydrazine (PubChem CID 105296014) has the molecular formula C12H17ClN2S and a molecular weight of 256.80 g/mol. Its IUPAC name is [1-(6-bicyclo[3.1.0]hexanyl)-2-(5-chlorothiophen-2-yl)ethyl]hydrazine.
| Compound Name | [1-(6-bicyclo[3.1.0]hexanyl)-2-(5-chlorothiophen-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105296014 |
| Molecular Formula | C12H17ClN2S |
| Molecular Weight | 256.80 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | [1-(6-bicyclo[3.1.0]hexanyl)-2-(5-chlorothiophen-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)s1)C1C2CCCC21 |
| InChI | InChI=1S/C12H17ClN2S/c13-11-5-4-7(16-11)6-10(15-14)12-8-2-1-3-9(8)12/h4-5,8-10,12,15H,1-3,6,14H2 |
| InChIKey | VVIKMAMMKSGBNY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.80 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|