C12H20ClNS — CID 115841703
1-(5-chlorothiophen-2-yl)-3-ethyl-N-methylpentan-2-amine (PubChem CID 115841703) has the molecular formula C12H20ClNS and a molecular weight of 245.82 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-ethyl-N-methylpentan-2-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-ethyl-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 115841703 |
| Molecular Formula | C12H20ClNS |
| Molecular Weight | 245.82 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-ethyl-N-methylpentan-2-amine |
| SMILES | CCC(CC)C(Cc1ccc(Cl)s1)NC |
| InChI | InChI=1S/C12H20ClNS/c1-4-9(5-2)11(14-3)8-10-6-7-12(13)15-10/h6-7,9,11,14H,4-5,8H2,1-3H3 |
| InChIKey | VVVMNMLIARBUFW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.82 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |