C11H17Cl2NS — CID 106353765
1-chloro-N-[(5-chlorothiophen-2-yl)methyl]-4-methylpentan-3-amine (PubChem CID 106353765) has the molecular formula C11H17Cl2NS and a molecular weight of 266.24 g/mol. Its IUPAC name is 1-chloro-N-[(5-chlorothiophen-2-yl)methyl]-4-methylpentan-3-amine.
| Compound Name | 1-chloro-N-[(5-chlorothiophen-2-yl)methyl]-4-methylpentan-3-amine |
|---|---|
| PubChem CID | 106353765 |
| Molecular Formula | C11H17Cl2NS |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 1-chloro-N-[(5-chlorothiophen-2-yl)methyl]-4-methylpentan-3-amine |
| SMILES | CC(C)C(CCCl)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H17Cl2NS/c1-8(2)10(5-6-12)14-7-9-3-4-11(13)15-9/h3-4,8,10,14H,5-7H2,1-2H3 |
| InChIKey | KZWBWPAKRDLGTI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|