C11H17BrClNS — CID 106353716
N-[(4-bromothiophen-2-yl)methyl]-1-chloro-4-methylpentan-3-amine (PubChem CID 106353716) has the molecular formula C11H17BrClNS and a molecular weight of 310.69 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-1-chloro-4-methylpentan-3-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-1-chloro-4-methylpentan-3-amine |
|---|---|
| PubChem CID | 106353716 |
| Molecular Formula | C11H17BrClNS |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-1-chloro-4-methylpentan-3-amine |
| SMILES | CC(C)C(CCCl)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C11H17BrClNS/c1-8(2)11(3-4-13)14-6-10-5-9(12)7-15-10/h5,7-8,11,14H,3-4,6H2,1-2H3 |
| InChIKey | CUZLCFFREPXFOZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|