C16H20BrNS — CID 43223373
N-[(4-bromothiophen-2-yl)methyl]-1-(4-propan-2-ylphenyl)ethanamine (PubChem CID 43223373) has the molecular formula C16H20BrNS and a molecular weight of 338.31 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-1-(4-propan-2-ylphenyl)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-1-(4-propan-2-ylphenyl)ethanamine |
|---|---|
| PubChem CID | 43223373 |
| Molecular Formula | C16H20BrNS |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-1-(4-propan-2-ylphenyl)ethanamine |
| SMILES | CC(C)c1ccc(C(C)NCc2cc(Br)cs2)cc1 |
| InChI | InChI=1S/C16H20BrNS/c1-11(2)13-4-6-14(7-5-13)12(3)18-9-16-8-15(17)10-19-16/h4-8,10-12,18H,9H2,1-3H3 |
| InChIKey | OEVRYTFDGPSWMY-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |