C11H11Br2NS2 — CID 107167279
1-(4-bromothiophen-2-yl)-N-[(4-bromothiophen-2-yl)methyl]ethanamine (PubChem CID 107167279) has the molecular formula C11H11Br2NS2 and a molecular weight of 381.16 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-N-[(4-bromothiophen-2-yl)methyl]ethanamine.
| Compound Name | 1-(4-bromothiophen-2-yl)-N-[(4-bromothiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107167279 |
| Molecular Formula | C11H11Br2NS2 |
| Molecular Weight | 381.16 g/mol |
| Exact Mass | 378.87 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-N-[(4-bromothiophen-2-yl)methyl]ethanamine |
| SMILES | CC(NCc1cc(Br)cs1)c1cc(Br)cs1 |
| InChI | InChI=1S/C11H11Br2NS2/c1-7(11-3-9(13)6-16-11)14-4-10-2-8(12)5-15-10/h2-3,5-7,14H,4H2,1H3 |
| InChIKey | WAYYHANCULRYRO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.16 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |