C11H18ClNS — CID 63891076
1-(5-chlorothiophen-2-yl)-4,4-dimethylpentan-2-amine (PubChem CID 63891076) has the molecular formula C11H18ClNS and a molecular weight of 231.79 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-4,4-dimethylpentan-2-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-4,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 63891076 |
| Molecular Formula | C11H18ClNS |
| Molecular Weight | 231.79 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-4,4-dimethylpentan-2-amine |
| SMILES | CC(C)(C)CC(N)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H18ClNS/c1-11(2,3)7-8(13)6-9-4-5-10(12)14-9/h4-5,8H,6-7,13H2,1-3H3 |
| InChIKey | FYTNVKWMMJZXPI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.79 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |