C11H16ClNOS — CID 116611485
3-amino-1-(5-chlorothiophen-2-yl)-4,4-dimethylpentan-2-one (PubChem CID 116611485) has the molecular formula C11H16ClNOS and a molecular weight of 245.77 g/mol. Its IUPAC name is 3-amino-1-(5-chlorothiophen-2-yl)-4,4-dimethylpentan-2-one.
| Compound Name | 3-amino-1-(5-chlorothiophen-2-yl)-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 116611485 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-amino-1-(5-chlorothiophen-2-yl)-4,4-dimethylpentan-2-one |
| SMILES | CC(C)(C)C(N)C(=O)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H16ClNOS/c1-11(2,3)10(13)8(14)6-7-4-5-9(12)15-7/h4-5,10H,6,13H2,1-3H3 |
| InChIKey | RLCNNZUCHFNGIT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |