C9H12ClNO2S — CID 62962765
ethyl 2-amino-3-(5-chlorothiophen-2-yl)propanoate (PubChem CID 62962765) has the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. Its IUPAC name is ethyl 2-amino-3-(5-chlorothiophen-2-yl)propanoate.
| Compound Name | ethyl 2-amino-3-(5-chlorothiophen-2-yl)propanoate |
|---|---|
| PubChem CID | 62962765 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | ethyl 2-amino-3-(5-chlorothiophen-2-yl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C9H12ClNO2S/c1-2-13-9(12)7(11)5-6-3-4-8(10)14-6/h3-4,7H,2,5,11H2,1H3 |
| InChIKey | MEIVGUZSNWTNNF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |