C11H14ClNO4S — CID 124854439
ethyl (2S)-2-[[2-(5-chlorothiophen-2-yl)acetyl]amino]-3-hydroxypropanoate (PubChem CID 124854439) has the molecular formula C11H14ClNO4S and a molecular weight of 291.76 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-(5-chlorothiophen-2-yl)acetyl]amino]-3-hydroxypropanoate.
| Compound Name | ethyl (2S)-2-[[2-(5-chlorothiophen-2-yl)acetyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 124854439 |
| Molecular Formula | C11H14ClNO4S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | ethyl (2S)-2-[[2-(5-chlorothiophen-2-yl)acetyl]amino]-3-hydroxypropanoate |
| SMILES | CCOC(=O)[C@H](CO)NC(=O)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H14ClNO4S/c1-2-17-11(16)8(6-14)13-10(15)5-7-3-4-9(12)18-7/h3-4,8,14H,2,5-6H2,1H3,(H,13,15)/t8-/m0/s1 |
| InChIKey | XHWJDBRXCWRGMG-QMMMGPOBSA-N |
| XLogP | 0.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |