C18H23NO4S — CID 170885788
ethyl 2-amino-3-[5-[4-(dimethoxymethyl)phenyl]thiophen-2-yl]propanoate (PubChem CID 170885788) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is ethyl 2-amino-3-[5-[4-(dimethoxymethyl)phenyl]thiophen-2-yl]propanoate.
| Compound Name | ethyl 2-amino-3-[5-[4-(dimethoxymethyl)phenyl]thiophen-2-yl]propanoate |
|---|---|
| PubChem CID | 170885788 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | ethyl 2-amino-3-[5-[4-(dimethoxymethyl)phenyl]thiophen-2-yl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(-c2ccc(C(OC)OC)cc2)s1 |
| InChI | InChI=1S/C18H23NO4S/c1-4-23-17(20)15(19)11-14-9-10-16(24-14)12-5-7-13(8-6-12)18(21-2)22-3/h5-10,15,18H,4,11,19H2,1-3H3 |
| InChIKey | FIOTZLGWQNVEIN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|