C16H23ClOS — CID 65402113
1-(4-tert-butylcyclohexyl)-2-(5-chlorothiophen-2-yl)ethanone (PubChem CID 65402113) has the molecular formula C16H23ClOS and a molecular weight of 298.88 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexyl)-2-(5-chlorothiophen-2-yl)ethanone.
| Compound Name | 1-(4-tert-butylcyclohexyl)-2-(5-chlorothiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 65402113 |
| Molecular Formula | C16H23ClOS |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-(4-tert-butylcyclohexyl)-2-(5-chlorothiophen-2-yl)ethanone |
| SMILES | CC(C)(C)C1CCC(C(=O)Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C16H23ClOS/c1-16(2,3)12-6-4-11(5-7-12)14(18)10-13-8-9-15(17)19-13/h8-9,11-12H,4-7,10H2,1-3H3 |
| InChIKey | OBPXHFDVKSSZTF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |