C18H24Cl2O — CID 107307912
1-(4-tert-butylcyclohexyl)-2-(2,3-dichlorophenyl)ethanone (PubChem CID 107307912) has the molecular formula C18H24Cl2O and a molecular weight of 327.30 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexyl)-2-(2,3-dichlorophenyl)ethanone.
| Compound Name | 1-(4-tert-butylcyclohexyl)-2-(2,3-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 107307912 |
| Molecular Formula | C18H24Cl2O |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-(4-tert-butylcyclohexyl)-2-(2,3-dichlorophenyl)ethanone |
| SMILES | CC(C)(C)C1CCC(C(=O)Cc2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C18H24Cl2O/c1-18(2,3)14-9-7-12(8-10-14)16(21)11-13-5-4-6-15(19)17(13)20/h4-6,12,14H,7-11H2,1-3H3 |
| InChIKey | KHICWCCKLKIUID-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |