C17H23BrCl2 — CID 107309494
1-[(2-bromo-5-tert-butylcyclohexyl)methyl]-2,3-dichlorobenzene (PubChem CID 107309494) has the molecular formula C17H23BrCl2 and a molecular weight of 378.18 g/mol. Its IUPAC name is 1-[(2-bromo-5-tert-butylcyclohexyl)methyl]-2,3-dichlorobenzene.
| Compound Name | 1-[(2-bromo-5-tert-butylcyclohexyl)methyl]-2,3-dichlorobenzene |
|---|---|
| PubChem CID | 107309494 |
| Molecular Formula | C17H23BrCl2 |
| Molecular Weight | 378.18 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 1-[(2-bromo-5-tert-butylcyclohexyl)methyl]-2,3-dichlorobenzene |
| SMILES | CC(C)(C)C1CCC(Br)C(Cc2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C17H23BrCl2/c1-17(2,3)13-7-8-14(18)12(10-13)9-11-5-4-6-15(19)16(11)20/h4-6,12-14H,7-10H2,1-3H3 |
| InChIKey | BQIRGDKLGNMBGU-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.18 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|