C12H13BrCl2 — CID 107309484
1-[(2-bromocyclopentyl)methyl]-2,3-dichlorobenzene (PubChem CID 107309484) has the molecular formula C12H13BrCl2 and a molecular weight of 308.05 g/mol. Its IUPAC name is 1-[(2-bromocyclopentyl)methyl]-2,3-dichlorobenzene.
| Compound Name | 1-[(2-bromocyclopentyl)methyl]-2,3-dichlorobenzene |
|---|---|
| PubChem CID | 107309484 |
| Molecular Formula | C12H13BrCl2 |
| Molecular Weight | 308.05 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 1-[(2-bromocyclopentyl)methyl]-2,3-dichlorobenzene |
| SMILES | Clc1cccc(CC2CCCC2Br)c1Cl |
| InChI | InChI=1S/C12H13BrCl2/c13-10-5-1-3-8(10)7-9-4-2-6-11(14)12(9)15/h2,4,6,8,10H,1,3,5,7H2 |
| InChIKey | BTAQAIVLVSDIFA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.05 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|