C13H16BrF — CID 63471632
1-[(2-bromocyclohexyl)methyl]-2-fluorobenzene (PubChem CID 63471632) has the molecular formula C13H16BrF and a molecular weight of 271.17 g/mol. Its IUPAC name is 1-[(2-bromocyclohexyl)methyl]-2-fluorobenzene.
| Compound Name | 1-[(2-bromocyclohexyl)methyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 63471632 |
| Molecular Formula | C13H16BrF |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 1-[(2-bromocyclohexyl)methyl]-2-fluorobenzene |
| SMILES | Fc1ccccc1CC1CCCCC1Br |
| InChI | InChI=1S/C13H16BrF/c14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15/h2,4,6,8,10,12H,1,3,5,7,9H2 |
| InChIKey | HREKXUFGGDMHIW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|