C13H16BrCl — CID 63471819
1-[(2-bromocyclohexyl)methyl]-3-chlorobenzene (PubChem CID 63471819) has the molecular formula C13H16BrCl and a molecular weight of 287.63 g/mol. Its IUPAC name is 1-[(2-bromocyclohexyl)methyl]-3-chlorobenzene.
| Compound Name | 1-[(2-bromocyclohexyl)methyl]-3-chlorobenzene |
|---|---|
| PubChem CID | 63471819 |
| Molecular Formula | C13H16BrCl |
| Molecular Weight | 287.63 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 1-[(2-bromocyclohexyl)methyl]-3-chlorobenzene |
| SMILES | Clc1cccc(CC2CCCCC2Br)c1 |
| InChI | InChI=1S/C13H16BrCl/c14-13-7-2-1-5-11(13)8-10-4-3-6-12(15)9-10/h3-4,6,9,11,13H,1-2,5,7-8H2 |
| InChIKey | VQDAOOBQCXPEBO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|